C48H50N4O4 — CID 135578098
methyl 2-[2,8,12,18-tetraethyl-15-(2-methoxycarbonylphenyl)-3,7,13,17-tetramethyl-21,23-dihydroporphyrin-5-yl]benzoate (PubChem CID 135578098) has the molecular formula C48H50N4O4 and a molecular weight of 746.95 g/mol. Its IUPAC name is methyl 2-[2,8,12,18-tetraethyl-15-(2-methoxycarbonylphenyl)-3,7,13,17-tetramethyl-21,23-dihydroporphyrin-5-yl]benzoate.
| Compound Name | methyl 2-[2,8,12,18-tetraethyl-15-(2-methoxycarbonylphenyl)-3,7,13,17-tetramethyl-21,23-dihydroporphyrin-5-yl]benzoate |
|---|---|
| PubChem CID | 135578098 |
| Molecular Formula | C48H50N4O4 |
| Molecular Weight | 746.95 g/mol |
| Exact Mass | 746.38 |
| IUPAC Name | methyl 2-[2,8,12,18-tetraethyl-15-(2-methoxycarbonylphenyl)-3,7,13,17-tetramethyl-21,23-dihydroporphyrin-5-yl]benzoate |
| SMILES | CCC1=C(C)c2nc1cc1[nH]c(c(C)c1CC)c(-c1ccccc1C(=O)OC)c1nc(cc3[nH]c(c(C)c3CC)c2-c2ccccc2C(=O)OC)C(CC)=C1C |
| InChI | InChI=1S/C48H50N4O4/c1-11-29-25(5)43-41(33-19-15-17-21-35(33)47(53)55-9)44-27(7)31(13-3)39(51-44)24-40-32(14-4)28(8)46(52-40)42(34-20-16-18-22-36(34)48(54)56-10)45-26(6)30(12-2)38(50-45)23-37(29)49-43/h15-24,49,52H,11-14H2,1-10H3/b37-23-,38-23-,39-24-,40-24-,43-41-,44-41-,45-42-,46-42- |
| InChIKey | UBAVFPLVOVWGEW-HLGYMJBZSA-N |
| XLogP | 11.65 |
| TPSA | 109.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.95 |
| LogP ≤ 5 | 11.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |