C52H61IN4 — CID 10985754
5-(3,5-ditert-butylphenyl)-2,8,12,18-tetraethyl-15-(4-iodophenyl)-3,7,13,17-tetramethyl-21,22-dihydroporphyrin (PubChem CID 10985754) has the molecular formula C52H61IN4 and a molecular weight of 868.99 g/mol. Its IUPAC name is 5-(3,5-ditert-butylphenyl)-2,8,12,18-tetraethyl-15-(4-iodophenyl)-3,7,13,17-tetramethyl-21,22-dihydroporphyrin.
| Compound Name | 5-(3,5-ditert-butylphenyl)-2,8,12,18-tetraethyl-15-(4-iodophenyl)-3,7,13,17-tetramethyl-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 10985754 |
| Molecular Formula | C52H61IN4 |
| Molecular Weight | 868.99 g/mol |
| Exact Mass | 868.39 |
| IUPAC Name | 5-(3,5-ditert-butylphenyl)-2,8,12,18-tetraethyl-15-(4-iodophenyl)-3,7,13,17-tetramethyl-21,22-dihydroporphyrin |
| SMILES | CCC1=C(C)c2nc1cc1[nH]c(c(C)c1CC)c(-c1cc(C(C)(C)C)cc(C(C)(C)C)c1)c1[nH]c(cc3nc(c2-c2ccc(I)cc2)C(C)=C3CC)c(CC)c1C |
| InChI | InChI=1S/C52H61IN4/c1-15-37-28(5)47-45(32-19-21-36(53)22-20-32)48-29(6)38(16-2)42(55-48)27-44-40(18-4)31(8)50(57-44)46(49-30(7)39(17-3)43(56-49)26-41(37)54-47)33-23-34(51(9,10)11)25-35(24-33)52(12,13)14/h19-27,56-57H,15-18H2,1-14H3/b41-26-,42-27-,43-26-,44-27-,47-45-,48-45-,49-46-,50-46- |
| InChIKey | KKDBJKSZTFCJTR-IWBGONGBSA-N |
| XLogP | 15.27 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 868.99 |
| LogP ≤ 5 | 15.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|