C44H46N4O2 — CID 137231820
4-[2,8,12,18-tetraethyl-15-(4-hydroxyphenyl)-3,7,13,17-tetramethyl-21,23-dihydroporphyrin-5-yl]phenol (PubChem CID 137231820) has the molecular formula C44H46N4O2 and a molecular weight of 662.88 g/mol. Its IUPAC name is 4-[2,8,12,18-tetraethyl-15-(4-hydroxyphenyl)-3,7,13,17-tetramethyl-21,23-dihydroporphyrin-5-yl]phenol.
| Compound Name | 4-[2,8,12,18-tetraethyl-15-(4-hydroxyphenyl)-3,7,13,17-tetramethyl-21,23-dihydroporphyrin-5-yl]phenol |
|---|---|
| PubChem CID | 137231820 |
| Molecular Formula | C44H46N4O2 |
| Molecular Weight | 662.88 g/mol |
| Exact Mass | 662.36 |
| IUPAC Name | 4-[2,8,12,18-tetraethyl-15-(4-hydroxyphenyl)-3,7,13,17-tetramethyl-21,23-dihydroporphyrin-5-yl]phenol |
| SMILES | CCC1=C(C)c2nc1cc1[nH]c(c(C)c1CC)c(-c1ccc(O)cc1)c1nc(cc3[nH]c(c(C)c3CC)c2-c2ccc(O)cc2)C(CC)=C1C |
| InChI | InChI=1S/C44H46N4O2/c1-9-31-23(5)41-39(27-13-17-29(49)18-14-27)42-25(7)33(11-3)37(47-42)22-38-34(12-4)26(8)44(48-38)40(28-15-19-30(50)20-16-28)43-24(6)32(10-2)36(46-43)21-35(31)45-41/h13-22,45,48-50H,9-12H2,1-8H3/b35-21-,36-21-,37-22-,38-22-,41-39-,42-39-,43-40-,44-40- |
| InChIKey | DYWUCOOBFXKVKE-SVOHXFSLSA-N |
| XLogP | 11.48 |
| TPSA | 97.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.88 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |