C54H53N5O2 — CID 136859423
2-[15-[4-(dimethylamino)phenyl]-2,8,12,18-tetraethyl-3,7,13,17-tetramethyl-21,23-dihydroporphyrin-5-yl]anthracene-9,10-dione (PubChem CID 136859423) has the molecular formula C54H53N5O2 and a molecular weight of 804.05 g/mol. Its IUPAC name is 2-[15-[4-(dimethylamino)phenyl]-2,8,12,18-tetraethyl-3,7,13,17-tetramethyl-21,23-dihydroporphyrin-5-yl]anthracene-9,10-dione.
| Compound Name | 2-[15-[4-(dimethylamino)phenyl]-2,8,12,18-tetraethyl-3,7,13,17-tetramethyl-21,23-dihydroporphyrin-5-yl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 136859423 |
| Molecular Formula | C54H53N5O2 |
| Molecular Weight | 804.05 g/mol |
| Exact Mass | 803.42 |
| IUPAC Name | 2-[15-[4-(dimethylamino)phenyl]-2,8,12,18-tetraethyl-3,7,13,17-tetramethyl-21,23-dihydroporphyrin-5-yl]anthracene-9,10-dione |
| SMILES | CCC1=C(C)c2nc1cc1[nH]c(c(C)c1CC)c(-c1ccc(N(C)C)cc1)c1nc(cc3[nH]c(c(C)c3CC)c2-c2ccc3c(c2)C(=O)c2ccccc2C3=O)C(CC)=C1C |
| InChI | InChI=1S/C54H53N5O2/c1-11-35-28(5)49-47(32-19-22-34(23-20-32)59(9)10)50-29(6)36(12-2)44(56-50)27-46-38(14-4)31(8)52(58-46)48(51-30(7)37(13-3)45(57-51)26-43(35)55-49)33-21-24-41-42(25-33)54(61)40-18-16-15-17-39(40)53(41)60/h15-27,55,58H,11-14H2,1-10H3/b43-26-,44-27-,45-26-,46-27-,49-47-,50-47-,51-48-,52-48- |
| InChIKey | ABLYBVCAPOXXIP-UWLSGXOMSA-N |
| XLogP | 12.91 |
| TPSA | 94.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.05 |
| LogP ≤ 5 | 12.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|