C60H78N4O — CID 136756470
3-(2,8,12,18-tetrahexyl-3,7,13,17-tetramethyl-15-phenyl-21,23-dihydroporphyrin-5-yl)phenol (PubChem CID 136756470) has the molecular formula C60H78N4O and a molecular weight of 871.31 g/mol. Its IUPAC name is 3-(2,8,12,18-tetrahexyl-3,7,13,17-tetramethyl-15-phenyl-21,23-dihydroporphyrin-5-yl)phenol.
| Compound Name | 3-(2,8,12,18-tetrahexyl-3,7,13,17-tetramethyl-15-phenyl-21,23-dihydroporphyrin-5-yl)phenol |
|---|---|
| PubChem CID | 136756470 |
| Molecular Formula | C60H78N4O |
| Molecular Weight | 871.31 g/mol |
| Exact Mass | 870.62 |
| IUPAC Name | 3-(2,8,12,18-tetrahexyl-3,7,13,17-tetramethyl-15-phenyl-21,23-dihydroporphyrin-5-yl)phenol |
| SMILES | CCCCCCC1=C(C)c2nc1cc1[nH]c(c(C)c1CCCCCC)c(-c1ccccc1)c1nc(cc3[nH]c(c(C)c3CCCCCC)c2-c2cccc(O)c2)C(CCCCCC)=C1C |
| InChI | InChI=1S/C60H78N4O/c1-9-13-17-24-33-47-40(5)57-55(44-29-22-21-23-30-44)58-41(6)48(34-25-18-14-10-2)52(62-58)39-54-50(36-27-20-16-12-4)43(8)60(64-54)56(45-31-28-32-46(65)37-45)59-42(7)49(35-26-19-15-11-3)53(63-59)38-51(47)61-57/h21-23,28-32,37-39,61,64-65H,9-20,24-27,33-36H2,1-8H3/b51-38-,52-39-,53-38-,54-39-,57-55-,58-55-,59-56-,60-56- |
| InChIKey | NQFZJJLTKICAQS-RTDUODERSA-N |
| XLogP | 18.02 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.31 |
| LogP ≤ 5 | 18.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|