C70H94N4 — CID 10677453
5-(3,5-ditert-butylphenyl)-15-(4-ethynylphenyl)-2,8,12,18-tetrahexyl-3,7,13,17-tetramethyl-21,22-dihydroporphyrin (PubChem CID 10677453) has the molecular formula C70H94N4 and a molecular weight of 991.55 g/mol. Its IUPAC name is 5-(3,5-ditert-butylphenyl)-15-(4-ethynylphenyl)-2,8,12,18-tetrahexyl-3,7,13,17-tetramethyl-21,22-dihydroporphyrin.
| Compound Name | 5-(3,5-ditert-butylphenyl)-15-(4-ethynylphenyl)-2,8,12,18-tetrahexyl-3,7,13,17-tetramethyl-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 10677453 |
| Molecular Formula | C70H94N4 |
| Molecular Weight | 991.55 g/mol |
| Exact Mass | 990.75 |
| IUPAC Name | 5-(3,5-ditert-butylphenyl)-15-(4-ethynylphenyl)-2,8,12,18-tetrahexyl-3,7,13,17-tetramethyl-21,22-dihydroporphyrin |
| SMILES | C#Cc1ccc(-c2c3nc(cc4[nH]c(c(C)c4CCCCCC)c(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c4[nH]c(cc5nc2C(C)=C5CCCCCC)c(CCCCCC)c4C)C(CCCCCC)=C3C)cc1 |
| InChI | InChI=1S/C70H94N4/c1-16-21-25-29-33-55-46(6)65-63(51-39-37-50(20-5)38-40-51)66-47(7)56(34-30-26-22-17-2)60(72-66)45-62-58(36-32-28-24-19-4)49(9)68(74-62)64(52-41-53(69(10,11)12)43-54(42-52)70(13,14)15)67-48(8)57(35-31-27-23-18-3)61(73-67)44-59(55)71-65/h5,37-45,73-74H,16-19,21-36H2,1-4,6-15H3/b59-44-,60-45-,61-44-,62-45-,65-63-,66-63-,67-64-,68-64- |
| InChIKey | XTJVRGKCTYTKBJ-AKHNRCEPSA-N |
| XLogP | 20.89 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 991.55 |
| LogP ≤ 5 | 20.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|