C65H86N4OZn — CID 15973233
zinc [4-[15-(4-tert-butylphenyl)-2,8,12,18-tetrahexyl-3,7,13,17-tetramethylporphyrin-21,22-diid-5-yl]phenyl]methanol (PubChem CID 15973233) has the molecular formula C65H86N4OZn and a molecular weight of 1004.82 g/mol. Its IUPAC name is zinc [4-[15-(4-tert-butylphenyl)-2,8,12,18-tetrahexyl-3,7,13,17-tetramethylporphyrin-21,22-diid-5-yl]phenyl]methanol.
| Compound Name | zinc [4-[15-(4-tert-butylphenyl)-2,8,12,18-tetrahexyl-3,7,13,17-tetramethylporphyrin-21,22-diid-5-yl]phenyl]methanol |
|---|---|
| PubChem CID | 15973233 |
| Molecular Formula | C65H86N4OZn |
| Molecular Weight | 1004.82 g/mol |
| Exact Mass | 1002.61 |
| IUPAC Name | zinc [4-[15-(4-tert-butylphenyl)-2,8,12,18-tetrahexyl-3,7,13,17-tetramethylporphyrin-21,22-diid-5-yl]phenyl]methanol |
| SMILES | CCCCCCC1=C(C)c2nc1cc1[n-]c(c(C)c1CCCCCC)c(-c1ccc(CO)cc1)c1[n-]c(cc3nc(c2-c2ccc(C(C)(C)C)cc2)C(C)=C3CCCCCC)c(CCCCCC)c1C.[Zn+2] |
| InChI | InChI=1S/C65H86N4O.Zn/c1-12-16-20-24-28-51-43(5)61-59(48-34-32-47(42-70)33-35-48)62-44(6)52(29-25-21-17-13-2)56(67-62)41-58-54(31-27-23-19-15-4)46(8)64(69-58)60(49-36-38-50(39-37-49)65(9,10)11)63-45(7)53(30-26-22-18-14-3)57(68-63)40-55(51)66-61;/h32-41,70H,12-31,42H2,1-11H3;/q-2;+2/b55-40-,56-41-,57-40-,58-41-,61-59-,62-59-,63-60-,64-60-; |
| InChIKey | GFYOMSQFAPSJEP-LXXWICBHSA-N |
| XLogP | 18.36 |
| TPSA | 74.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1004.82 |
| LogP ≤ 5 | 18.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|