C62H64N4Zn — CID 11061997
zinc 5-(3,5-ditert-butylphenyl)-2,8,12,18-tetraethyl-15-[4-[2-(4-ethynylphenyl)ethynyl]phenyl]-3,7,13,17-tetramethylporphyrin-22,24-diide (PubChem CID 11061997) has the molecular formula C62H64N4Zn and a molecular weight of 930.61 g/mol. Its IUPAC name is zinc 5-(3,5-ditert-butylphenyl)-2,8,12,18-tetraethyl-15-[4-[2-(4-ethynylphenyl)ethynyl]phenyl]-3,7,13,17-tetramethylporphyrin-22,24-diide.
| Compound Name | zinc 5-(3,5-ditert-butylphenyl)-2,8,12,18-tetraethyl-15-[4-[2-(4-ethynylphenyl)ethynyl]phenyl]-3,7,13,17-tetramethylporphyrin-22,24-diide |
|---|---|
| PubChem CID | 11061997 |
| Molecular Formula | C62H64N4Zn |
| Molecular Weight | 930.61 g/mol |
| Exact Mass | 928.44 |
| IUPAC Name | zinc 5-(3,5-ditert-butylphenyl)-2,8,12,18-tetraethyl-15-[4-[2-(4-ethynylphenyl)ethynyl]phenyl]-3,7,13,17-tetramethylporphyrin-22,24-diide |
| SMILES | C#Cc1ccc(C#Cc2ccc(-c3c4nc(cc5[n-]c(c(C)c5CC)c(-c5cc(C(C)(C)C)cc(C(C)(C)C)c5)c5nc(cc6[n-]c3c(C)c6CC)C(CC)=C5C)C(CC)=C4C)cc2)cc1.[Zn+2] |
| InChI | InChI=1S/C62H64N4.Zn/c1-16-40-21-23-41(24-22-40)25-26-42-27-29-43(30-28-42)55-57-36(6)47(17-2)51(63-57)34-53-49(19-4)38(8)59(65-53)56(44-31-45(61(10,11)12)33-46(32-44)62(13,14)15)60-39(9)50(20-5)54(66-60)35-52-48(18-3)37(7)58(55)64-52;/h1,21-24,27-35H,17-20H2,2-15H3;/q-2;+2/b51-34-,52-35-,53-34-,54-35-,57-55-,58-55-,59-56-,60-56-; |
| InChIKey | MCMJQQUERBBHQR-MALCQCBKSA-N |
| XLogP | 15.30 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 930.61 |
| LogP ≤ 5 | 15.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|