C44H48N4Ni — CID 10818419
nickel(2+);2,3,7,8,12,13,17,18-octaethyl-5-(2-phenylethynyl)porphyrin-22,24-diide (PubChem CID 10818419) has the molecular formula C44H48N4Ni and a molecular weight of 691.59 g/mol. Its IUPAC name is nickel(2+);2,3,7,8,12,13,17,18-octaethyl-5-(2-phenylethynyl)porphyrin-22,24-diide.
| Compound Name | nickel(2+);2,3,7,8,12,13,17,18-octaethyl-5-(2-phenylethynyl)porphyrin-22,24-diide |
|---|---|
| PubChem CID | 10818419 |
| Molecular Formula | C44H48N4Ni |
| Molecular Weight | 691.59 g/mol |
| Exact Mass | 690.32 |
| IUPAC Name | nickel(2+);2,3,7,8,12,13,17,18-octaethyl-5-(2-phenylethynyl)porphyrin-22,24-diide |
| SMILES | CCC1=C(CC)c2cc3[n-]c(c(C#Cc4ccccc4)c4nc(cc5[n-]c(cc1n2)c(CC)c5CC)C(CC)=C4CC)c(CC)c3CC.[Ni+2] |
| InChI | InChI=1S/C44H48N4.Ni/c1-9-28-30(11-3)39-25-41-32(13-5)34(15-7)43(47-41)36(23-22-27-20-18-17-19-21-27)44-35(16-8)33(14-6)42(48-44)26-40-31(12-4)29(10-2)38(46-40)24-37(28)45-39;/h17-21,24-26H,9-16H2,1-8H3;/q-2;+2/b37-24-,38-24-,39-25-,40-26-,41-25-,42-26-,43-36-,44-36-; |
| InChIKey | FKCCPYWVNPNSFZ-DTQBKDNDSA-N |
| XLogP | 10.68 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.59 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|