C37H47N4Pt+ — CID 58666241
2,3,7,8,12,13,17,18-octaethyl-21-methylporphyrin-21-ium-22,24-diide;platinum(2+) (PubChem CID 58666241) has the molecular formula C37H47N4Pt+ and a molecular weight of 742.89 g/mol. Its IUPAC name is 2,3,7,8,12,13,17,18-octaethyl-21-methylporphyrin-21-ium-22,24-diide;platinum(2+).
| Compound Name | 2,3,7,8,12,13,17,18-octaethyl-21-methylporphyrin-21-ium-22,24-diide;platinum(2+) |
|---|---|
| PubChem CID | 58666241 |
| Molecular Formula | C37H47N4Pt+ |
| Molecular Weight | 742.89 g/mol |
| Exact Mass | 742.34 |
| IUPAC Name | 2,3,7,8,12,13,17,18-octaethyl-21-methylporphyrin-21-ium-22,24-diide;platinum(2+) |
| SMILES | CCC1=C(CC)c2cc3[n-]c(cc4[n+](C)c(cc5[n-]c(cc1n2)c(CC)c5CC)C(CC)=C4CC)c(CC)c3CC.[Pt+2] |
| InChI | InChI=1S/C37H47N4.Pt/c1-10-22-23(11-2)31-19-33-25(13-4)27(15-6)35(40-33)21-37-29(17-8)28(16-7)36(41(37)9)20-34-26(14-5)24(12-3)32(39-34)18-30(22)38-31;/h18-21H,10-17H2,1-9H3;/q-1;+2/b30-18-,31-19-,32-18-,33-19-,34-20-,35-21-,36-20-,37-21-; |
| InChIKey | OLHPIMONVXKICR-MJYCZNDISA-N |
| XLogP | 8.71 |
| TPSA | 44.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.89 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|