C37H45N3Pt — CID 59398931
CID 59398931 (PubChem CID 59398931) has the molecular formula C37H45N3Pt and a molecular weight of 726.87 g/mol.
| Compound Name | CID 59398931 |
|---|---|
| PubChem CID | 59398931 |
| Molecular Formula | C37H45N3Pt |
| Molecular Weight | 726.87 g/mol |
| Exact Mass | 726.33 |
| IUPAC Name | — |
| SMILES | CCC1=C(CC)c2cc3[n-]c(cc4nc(cc5[cH-]c(cc1n2)c(CC)c5CC)C(CC)=C4CC)c(CC)c3CC.[Pt+2] |
| InChI | InChI=1S/C37H45N3.Pt/c1-9-24-22-17-23(25(24)10-2)19-33-27(12-4)29(14-6)35(39-33)21-37-31(16-8)30(15-7)36(40-37)20-34-28(13-5)26(11-3)32(18-22)38-34;/h17-21H,9-16H2,1-8H3;/q-2;+2/b22-18+,23-19+,32-18-,33-19-,34-20-,35-21-,36-20-,37-21-; |
| InChIKey | YFGUNUWXCJLSIE-YIZIMHDZSA-N |
| XLogP | 10.04 |
| TPSA | 39.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.87 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|