About CID 59398931
CID 59398931 (PubChem CID 59398931) has the molecular formula C37H45N3Pt
and a molecular weight of 726.87 g/mol.
Molecular Properties
| Compound Name | CID 59398931 |
| PubChem CID | 59398931 |
| Molecular Formula | C37H45N3Pt |
| Molecular Weight | 726.87 g/mol |
| Exact Mass | 726.33 |
| IUPAC Name | — |
| SMILES | CCC1=C(CC)c2cc3[n-]c(cc4nc(cc5[cH-]c(cc1n2)c(CC)c5CC)C(CC)=C4CC)c(CC)c3CC.[Pt+2] |
| InChI | InChI=1S/C37H45N3.Pt/c1-9-24-22-17-23(25(24)10-2)19-33-27(12-4)29(14-6)35(39-33)21-37-31(16-8)30(15-7)36(40-37)20-34-28(13-5)26(11-3)32(18-22)38-34;/h17-21H,9-16H2,1-8H3;/q-2;+2/b22-18+,23-19+,32-18-,33-19-,34-20-,35-21-,36-20-,37-21-; |
| InChIKey | YFGUNUWXCJLSIE-YIZIMHDZSA-N |
| XLogP | 10.04 |
| TPSA | 39.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 726.87 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 59398931 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59398931?
The IUPAC name of CID 59398931 (CID 59398931) is not available.
What is the SMILES notation for CID 59398931?
The canonical SMILES for CID 59398931 is CCC1=C(CC)c2cc3[n-]c(cc4nc(cc5[cH-]c(cc1n2)c(CC)c5CC)C(CC)=C4CC)c(CC)c3CC.[Pt+2].
What is the InChIKey of CID 59398931?
The InChIKey is YFGUNUWXCJLSIE-YIZIMHDZSA-N. The full InChI is InChI=1S/C37H45N3.Pt/c1-9-24-22-17-23(25(24)10-2)19-33-27(12-4)29(14-6)35(39-33)21-37-31(16-8)30(15-7)36(40-37)20-34-28(13-5)26(11-3)32(18-22)38-34;/h17-21H,9-16H2,1-8H3;/q-2;+2/b22-18+,23-19+,32-18-,33-19-,34-20-,35-21-,36-20-,37-21-;.
What are the key properties of CID 59398931?
CID 59398931 has a molecular weight of 726.87 g/mol, XLogP of 10.04, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59398931 is sourced from PubChem (CID 59398931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).