C39H51N5Ni — CID 11028678
N,N-dimethyl-1-(2,3,7,8,12,13,17,18-octaethylporphyrin-22,24-diid-5-yl)methanamine;nickel(2+) (PubChem CID 11028678) has the molecular formula C39H51N5Ni and a molecular weight of 648.57 g/mol. Its IUPAC name is N,N-dimethyl-1-(2,3,7,8,12,13,17,18-octaethylporphyrin-22,24-diid-5-yl)methanamine;nickel(2+).
| Compound Name | N,N-dimethyl-1-(2,3,7,8,12,13,17,18-octaethylporphyrin-22,24-diid-5-yl)methanamine;nickel(2+) |
|---|---|
| PubChem CID | 11028678 |
| Molecular Formula | C39H51N5Ni |
| Molecular Weight | 648.57 g/mol |
| Exact Mass | 647.35 |
| IUPAC Name | N,N-dimethyl-1-(2,3,7,8,12,13,17,18-octaethylporphyrin-22,24-diid-5-yl)methanamine;nickel(2+) |
| SMILES | CCC1=C(CC)c2cc3[n-]c(c(CN(C)C)c4nc(cc5[n-]c(cc1n2)c(CC)c5CC)C(CC)=C4CC)c(CC)c3CC.[Ni+2] |
| InChI | InChI=1S/C39H51N5.Ni/c1-11-23-25(13-3)34-20-36-27(15-5)29(17-7)38(42-36)31(22-44(9)10)39-30(18-8)28(16-6)37(43-39)21-35-26(14-4)24(12-2)33(41-35)19-32(23)40-34;/h19-21H,11-18,22H2,1-10H3;/q-2;+2/b32-19-,33-19-,34-20-,35-21-,36-20-,37-21-,38-31-,39-31-; |
| InChIKey | IYJGSSMPVBJNTO-BTGXSRSRSA-N |
| XLogP | 9.34 |
| TPSA | 57.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.57 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |