C48H44N4Zn — CID 10462737
zinc 2,8,12,18-tetraethyl-5,15-bis(3-ethynylphenyl)-3,7,13,17-tetramethylporphyrin-22,24-diide (PubChem CID 10462737) has the molecular formula C48H44N4Zn and a molecular weight of 742.30 g/mol. Its IUPAC name is zinc 2,8,12,18-tetraethyl-5,15-bis(3-ethynylphenyl)-3,7,13,17-tetramethylporphyrin-22,24-diide.
| Compound Name | zinc 2,8,12,18-tetraethyl-5,15-bis(3-ethynylphenyl)-3,7,13,17-tetramethylporphyrin-22,24-diide |
|---|---|
| PubChem CID | 10462737 |
| Molecular Formula | C48H44N4Zn |
| Molecular Weight | 742.30 g/mol |
| Exact Mass | 740.29 |
| IUPAC Name | zinc 2,8,12,18-tetraethyl-5,15-bis(3-ethynylphenyl)-3,7,13,17-tetramethylporphyrin-22,24-diide |
| SMILES | C#Cc1cccc(-c2c3nc(cc4[n-]c(c(C)c4CC)c(-c4cccc(C#C)c4)c4nc(cc5[n-]c2c(C)c5CC)C(CC)=C4C)C(CC)=C3C)c1.[Zn+2] |
| InChI | InChI=1S/C48H44N4.Zn/c1-11-31-19-17-21-33(23-31)43-45-27(7)35(13-3)39(49-45)25-41-37(15-5)29(9)47(51-41)44(34-22-18-20-32(12-2)24-34)48-30(10)38(16-6)42(52-48)26-40-36(14-4)28(8)46(43)50-40;/h1-2,17-26H,13-16H2,3-10H3;/q-2;+2/b39-25-,40-26-,41-25-,42-26-,45-43-,46-43-,47-44-,48-44-; |
| InChIKey | SDBPZJVQRNFIGX-NNCYMSOASA-N |
| XLogP | 11.29 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.30 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|