C35H38N4O4Zn — CID 59972114
zinc 3-[18-(2-carboxyethyl)-8,13-diethyl-3,7,12,15,17-pentamethylporphyrin-22,24-diid-2-yl]propanoic acid (PubChem CID 59972114) has the molecular formula C35H38N4O4Zn and a molecular weight of 644.10 g/mol. Its IUPAC name is zinc 3-[18-(2-carboxyethyl)-8,13-diethyl-3,7,12,15,17-pentamethylporphyrin-22,24-diid-2-yl]propanoic acid.
| Compound Name | zinc 3-[18-(2-carboxyethyl)-8,13-diethyl-3,7,12,15,17-pentamethylporphyrin-22,24-diid-2-yl]propanoic acid |
|---|---|
| PubChem CID | 59972114 |
| Molecular Formula | C35H38N4O4Zn |
| Molecular Weight | 644.10 g/mol |
| Exact Mass | 642.22 |
| IUPAC Name | zinc 3-[18-(2-carboxyethyl)-8,13-diethyl-3,7,12,15,17-pentamethylporphyrin-22,24-diid-2-yl]propanoic acid |
| SMILES | CCC1=C(C)c2cc3[n-]c(cc4nc(cc5[n-]c(c(C)c1n2)c(C)c5CCC(=O)O)C(CCC(=O)O)=C4C)c(C)c3CC.[Zn+2] |
| InChI | InChI=1S/C35H40N4O4.Zn/c1-8-22-17(3)26-14-27-19(5)24(10-12-32(40)41)30(37-27)16-31-25(11-13-33(42)43)20(6)34(39-31)21(7)35-23(9-2)18(4)28(38-35)15-29(22)36-26;/h14-16H,8-13H2,1-7H3,(H4,36,37,38,39,40,41,42,43);/q;+2/p-2/b26-14-,27-14-,28-15-,29-15-,30-16-,31-16-,34-21-,35-21-; |
| InChIKey | FQVQNDWJGMZJOD-NBOPXBJHSA-L |
| XLogP | 7.21 |
| TPSA | 128.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.10 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|