C38H44CoN4O4 — CID 59921652
3-[18-(3-acetyloxypropyl)-7,12-diethyl-3,8,13,17-tetramethylporphyrin-21,23-diid-2-yl]propyl acetate;cobalt(2+) (PubChem CID 59921652) has the molecular formula C38H44CoN4O4 and a molecular weight of 679.73 g/mol. Its IUPAC name is 3-[18-(3-acetyloxypropyl)-7,12-diethyl-3,8,13,17-tetramethylporphyrin-21,23-diid-2-yl]propyl acetate;cobalt(2+).
| Compound Name | 3-[18-(3-acetyloxypropyl)-7,12-diethyl-3,8,13,17-tetramethylporphyrin-21,23-diid-2-yl]propyl acetate;cobalt(2+) |
|---|---|
| PubChem CID | 59921652 |
| Molecular Formula | C38H44CoN4O4 |
| Molecular Weight | 679.73 g/mol |
| Exact Mass | 679.27 |
| IUPAC Name | 3-[18-(3-acetyloxypropyl)-7,12-diethyl-3,8,13,17-tetramethylporphyrin-21,23-diid-2-yl]propyl acetate;cobalt(2+) |
| SMILES | CCC1=C(C)c2cc3[n-]c(cc4nc(cc5[n-]c(cc1n2)c(C)c5CCCOC(C)=O)C(CCCOC(C)=O)=C4C)c(C)c3CC.[Co+2] |
| InChI | InChI=1S/C38H44N4O4.Co/c1-9-27-21(3)31-17-32-23(5)29(13-11-15-45-25(7)43)37(41-32)20-38-30(14-12-16-46-26(8)44)24(6)34(42-38)19-36-28(10-2)22(4)33(40-36)18-35(27)39-31;/h17-20H,9-16H2,1-8H3;/q-2;+2/b31-17-,32-17-,33-18-,34-19-,35-18-,36-19-,37-20-,38-20-; |
| InChIKey | DAIQRGRPIMJJIG-ADRFTTKGSA-N |
| XLogP | 7.86 |
| TPSA | 106.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.73 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|