C42H48N4O8Pd — CID 21129145
palladium(2+);3-[7,12,17-tris(3-ethoxy-3-oxopropyl)-3,8,13,18-tetramethylporphyrin-21,23-diid-2-yl]propanoic acid (PubChem CID 21129145) has the molecular formula C42H48N4O8Pd and a molecular weight of 843.29 g/mol. Its IUPAC name is palladium(2+);3-[7,12,17-tris(3-ethoxy-3-oxopropyl)-3,8,13,18-tetramethylporphyrin-21,23-diid-2-yl]propanoic acid.
| Compound Name | palladium(2+);3-[7,12,17-tris(3-ethoxy-3-oxopropyl)-3,8,13,18-tetramethylporphyrin-21,23-diid-2-yl]propanoic acid |
|---|---|
| PubChem CID | 21129145 |
| Molecular Formula | C42H48N4O8Pd |
| Molecular Weight | 843.29 g/mol |
| Exact Mass | 842.25 |
| IUPAC Name | palladium(2+);3-[7,12,17-tris(3-ethoxy-3-oxopropyl)-3,8,13,18-tetramethylporphyrin-21,23-diid-2-yl]propanoic acid |
| SMILES | CCOC(=O)CCC1=C(C)c2cc3[n-]c(cc4nc(cc5[n-]c(cc1n2)c(C)c5CCC(=O)O)C(C)=C4CCC(=O)OCC)c(C)c3CCC(=O)OCC.[Pd+2] |
| InChI | InChI=1S/C42H49N4O8.Pd/c1-8-52-40(49)16-12-28-24(5)32-19-35-27(11-15-39(47)48)23(4)31(43-35)20-36-29(13-17-41(50)53-9-2)25(6)33(45-36)22-38-30(14-18-42(51)54-10-3)26(7)34(46-38)21-37(28)44-32;/h19-22H,8-18H2,1-7H3,(H2-,43,44,45,46,47,48);/q-1;+2/p-1/b31-20-,32-19-,33-22-,34-21-,35-19-,36-20-,37-21-,38-22-; |
| InChIKey | RIPLQKHXZVXBMN-FFMYHAFKSA-M |
| XLogP | 7.25 |
| TPSA | 170.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.29 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|