C34H36N4O4Zn — CID 3777771
zinc ethyl 3-[18-(3-ethoxy-3-oxopropyl)-3,8,13,17-tetramethylporphyrin-21,23-diid-2-yl]propanoate (PubChem CID 3777771) has the molecular formula C34H36N4O4Zn and a molecular weight of 630.08 g/mol. Its IUPAC name is zinc ethyl 3-[18-(3-ethoxy-3-oxopropyl)-3,8,13,17-tetramethylporphyrin-21,23-diid-2-yl]propanoate.
| Compound Name | zinc ethyl 3-[18-(3-ethoxy-3-oxopropyl)-3,8,13,17-tetramethylporphyrin-21,23-diid-2-yl]propanoate |
|---|---|
| PubChem CID | 3777771 |
| Molecular Formula | C34H36N4O4Zn |
| Molecular Weight | 630.08 g/mol |
| Exact Mass | 628.20 |
| IUPAC Name | zinc ethyl 3-[18-(3-ethoxy-3-oxopropyl)-3,8,13,17-tetramethylporphyrin-21,23-diid-2-yl]propanoate |
| SMILES | CCOC(=O)CCC1=C(C)c2cc3[n-]c(cc4nc(cc5[n-]c(cc1n2)c(CCC(=O)OCC)c5C)C=C4C)cc3C.[Zn+2] |
| InChI | InChI=1S/C34H36N4O4.Zn/c1-7-41-33(39)11-9-25-21(5)29-16-24-13-19(3)27(35-24)15-23-14-20(4)28(36-23)17-30-22(6)26(10-12-34(40)42-8-2)32(38-30)18-31(25)37-29;/h13-18H,7-12H2,1-6H3;/q-2;+2/b23-15-,24-16-,27-15-,28-17-,29-16-,30-17-,31-18-,32-18-; |
| InChIKey | VHAMJGYEDMIXHW-XCWHVJJWSA-N |
| XLogP | 6.52 |
| TPSA | 106.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.08 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|