C30H32CuN4 — CID 134915764
copper 2,8,13-triethyl-3,7,12,17-tetramethylporphyrin-22,24-diide (PubChem CID 134915764) has the molecular formula C30H32CuN4 and a molecular weight of 512.16 g/mol. Its IUPAC name is copper 2,8,13-triethyl-3,7,12,17-tetramethylporphyrin-22,24-diide.
| Compound Name | copper 2,8,13-triethyl-3,7,12,17-tetramethylporphyrin-22,24-diide |
|---|---|
| PubChem CID | 134915764 |
| Molecular Formula | C30H32CuN4 |
| Molecular Weight | 512.16 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | copper 2,8,13-triethyl-3,7,12,17-tetramethylporphyrin-22,24-diide |
| SMILES | CCC1=C(C)c2cc3[n-]c(cc4nc(cc5[n-]c(cc1n2)cc5C)C(CC)=C4C)c(CC)c3C.[Cu+2] |
| InChI | InChI=1S/C30H32N4.Cu/c1-8-21-17(5)25-14-26-18(6)23(10-3)30(33-26)15-27-19(7)22(9-2)29(34-27)13-24-16(4)11-20(31-24)12-28(21)32-25;/h11-15H,8-10H2,1-7H3;/q-2;+2/b20-12-,24-13-,25-14-,26-14-,27-15-,28-12-,29-13-,30-15-; |
| InChIKey | VOKWIRHHEVUMBL-QWDQWIHHSA-N |
| XLogP | 7.43 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.16 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |