C32H32FeN4O4 — CID 171040619
iron(2+);methyl 3-[18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethylporphyrin-21,23-diid-2-yl]propanoate (PubChem CID 171040619) has the molecular formula C32H32FeN4O4 and a molecular weight of 592.48 g/mol. Its IUPAC name is iron(2+);methyl 3-[18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethylporphyrin-21,23-diid-2-yl]propanoate.
| Compound Name | iron(2+);methyl 3-[18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethylporphyrin-21,23-diid-2-yl]propanoate |
|---|---|
| PubChem CID | 171040619 |
| Molecular Formula | C32H32FeN4O4 |
| Molecular Weight | 592.48 g/mol |
| Exact Mass | 592.18 |
| IUPAC Name | iron(2+);methyl 3-[18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethylporphyrin-21,23-diid-2-yl]propanoate |
| SMILES | COC(=O)CCC1=C(C)c2cc3cc(C)c(cc4nc(cc5[n-]c(cc1n2)c(CCC(=O)OC)c5C)C(C)=C4)[n-]3.[Fe+2] |
| InChI | InChI=1S/C32H32N4O4.Fe/c1-17-11-22-14-27-19(3)23(7-9-31(37)39-5)29(35-27)16-30-24(8-10-32(38)40-6)20(4)28(36-30)15-26-18(2)12-21(34-26)13-25(17)33-22;/h11-16H,7-10H2,1-6H3;/q-2;+2/b21-13-,22-14-,25-13-,26-15-,27-14-,28-15-,29-16-,30-16-; |
| InChIKey | VYAKARKUBPDTGM-UQNLBECZSA-N |
| XLogP | 5.74 |
| TPSA | 106.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.48 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|