C38H40N4O6Zn — CID 15970024
zinc methyl 3-[18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-8,13-bis(oxiran-2-ylmethyl)porphyrin-22,23-diid-2-yl]propanoate (PubChem CID 15970024) has the molecular formula C38H40N4O6Zn and a molecular weight of 714.15 g/mol. Its IUPAC name is zinc methyl 3-[18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-8,13-bis(oxiran-2-ylmethyl)porphyrin-22,23-diid-2-yl]propanoate.
| Compound Name | zinc methyl 3-[18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-8,13-bis(oxiran-2-ylmethyl)porphyrin-22,23-diid-2-yl]propanoate |
|---|---|
| PubChem CID | 15970024 |
| Molecular Formula | C38H40N4O6Zn |
| Molecular Weight | 714.15 g/mol |
| Exact Mass | 712.22 |
| IUPAC Name | zinc methyl 3-[18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-8,13-bis(oxiran-2-ylmethyl)porphyrin-22,23-diid-2-yl]propanoate |
| SMILES | COC(=O)CCC1=C(C)c2cc3[n-]c(cc4[n-]c(cc5nc(cc1n2)C(CCC(=O)OC)=C5C)c(CC1CO1)c4C)c(CC1CO1)c3C.[Zn+2] |
| InChI | InChI=1S/C38H40N4O6.Zn/c1-19-25(7-9-37(43)45-5)33-16-34-26(8-10-38(44)46-6)20(2)31(40-34)14-35-28(12-24-18-48-24)22(4)32(42-35)15-36-27(11-23-17-47-23)21(3)30(41-36)13-29(19)39-33;/h13-16,23-24H,7-12,17-18H2,1-6H3;/q-2;+2/b29-13-,30-13-,31-14-,32-15-,33-16-,34-16-,35-14-,36-15-; |
| InChIKey | PRGMWZTWMMAERM-LAAIEUHASA-N |
| XLogP | 5.84 |
| TPSA | 131.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.15 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|