C38H44CoN4O6 — CID 6535195
cobalt(2+);methyl 3-[8,13-bis(1-methoxyethyl)-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethylporphyrin-21,24-diid-2-yl]propanoate (PubChem CID 6535195) has the molecular formula C38H44CoN4O6 and a molecular weight of 711.72 g/mol. Its IUPAC name is cobalt(2+);methyl 3-[8,13-bis(1-methoxyethyl)-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethylporphyrin-21,24-diid-2-yl]propanoate.
| Compound Name | cobalt(2+);methyl 3-[8,13-bis(1-methoxyethyl)-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethylporphyrin-21,24-diid-2-yl]propanoate |
|---|---|
| PubChem CID | 6535195 |
| Molecular Formula | C38H44CoN4O6 |
| Molecular Weight | 711.72 g/mol |
| Exact Mass | 711.26 |
| IUPAC Name | cobalt(2+);methyl 3-[8,13-bis(1-methoxyethyl)-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethylporphyrin-21,24-diid-2-yl]propanoate |
| SMILES | COC(=O)CCc1c(C)c2cc3nc(cc4nc(cc5[n-]c(cc1[n-]2)c(CCC(=O)OC)c5C)C(C(C)OC)=C4C)C(C(C)OC)=C3C.[Co+2] |
| InChI | InChI=1S/C38H44N4O6.Co/c1-19-25(11-13-35(43)47-9)31-18-32-26(12-14-36(44)48-10)20(2)28(40-32)16-33-38(24(6)46-8)22(4)30(42-33)17-34-37(23(5)45-7)21(3)29(41-34)15-27(19)39-31;/h15-18,23-24H,11-14H2,1-10H3;/q-2;+2/b27-15-,28-16-,29-15-,30-17-,31-18-,32-18-,33-16-,34-17-; |
| InChIKey | CLXKIPBVLVWKGW-XVSNTGNMSA-N |
| XLogP | 6.33 |
| TPSA | 125.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.72 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |