C32H31BrN4O4Zn — CID 15973441
zinc methyl 3-[13-bromo-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethylporphyrin-21,24-diid-2-yl]propanoate (PubChem CID 15973441) has the molecular formula C32H31BrN4O4Zn and a molecular weight of 680.92 g/mol. Its IUPAC name is zinc methyl 3-[13-bromo-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethylporphyrin-21,24-diid-2-yl]propanoate.
| Compound Name | zinc methyl 3-[13-bromo-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethylporphyrin-21,24-diid-2-yl]propanoate |
|---|---|
| PubChem CID | 15973441 |
| Molecular Formula | C32H31BrN4O4Zn |
| Molecular Weight | 680.92 g/mol |
| Exact Mass | 678.08 |
| IUPAC Name | zinc methyl 3-[13-bromo-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethylporphyrin-21,24-diid-2-yl]propanoate |
| SMILES | COC(=O)CCc1c(C)c2cc3nc(cc4nc(cc5[n-]c(cc1[n-]2)c(CCC(=O)OC)c5C)C(Br)=C4C)C=C3C.[Zn+2] |
| InChI | InChI=1S/C32H31BrN4O4.Zn/c1-16-11-20-12-24-19(4)32(33)29(37-24)14-26-18(3)22(8-10-31(39)41-6)28(36-26)15-27-21(7-9-30(38)40-5)17(2)25(35-27)13-23(16)34-20;/h11-15H,7-10H2,1-6H3;/q-2;+2/b20-12-,23-13-,24-12-,25-13-,26-14-,27-15-,28-15-,29-14-; |
| InChIKey | JXTRAKREAITIDB-MZRPVTIJSA-N |
| XLogP | 6.24 |
| TPSA | 106.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.92 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|