C52H48N4O4Zn — CID 10533616
zinc methyl 3-[7,12-bis[(E)-2-(4-ethenylphenyl)ethenyl]-18-(3-methoxy-3-oxopropyl)-3,8,13,17-tetramethylporphyrin-21,23-diid-2-yl]propanoate (PubChem CID 10533616) has the molecular formula C52H48N4O4Zn and a molecular weight of 858.37 g/mol. Its IUPAC name is zinc methyl 3-[7,12-bis[(E)-2-(4-ethenylphenyl)ethenyl]-18-(3-methoxy-3-oxopropyl)-3,8,13,17-tetramethylporphyrin-21,23-diid-2-yl]propanoate.
| Compound Name | zinc methyl 3-[7,12-bis[(E)-2-(4-ethenylphenyl)ethenyl]-18-(3-methoxy-3-oxopropyl)-3,8,13,17-tetramethylporphyrin-21,23-diid-2-yl]propanoate |
|---|---|
| PubChem CID | 10533616 |
| Molecular Formula | C52H48N4O4Zn |
| Molecular Weight | 858.37 g/mol |
| Exact Mass | 856.30 |
| IUPAC Name | zinc methyl 3-[7,12-bis[(E)-2-(4-ethenylphenyl)ethenyl]-18-(3-methoxy-3-oxopropyl)-3,8,13,17-tetramethylporphyrin-21,23-diid-2-yl]propanoate |
| SMILES | C=Cc1ccc(/C=C/C2=C(C)c3cc4[n-]c(cc5nc(cc6[n-]c(cc2n3)c(C)c6CCC(=O)OC)C(CCC(=O)OC)=C5C)c(C)c4/C=C/c2ccc(C=C)cc2)cc1.[Zn+2] |
| InChI | InChI=1S/C52H48N4O4.Zn/c1-9-35-11-15-37(16-12-35)19-21-39-31(3)43-27-44-33(5)41(23-25-51(57)59-7)49(54-44)30-50-42(24-26-52(58)60-8)34(6)46(56-50)29-48-40(32(4)45(55-48)28-47(39)53-43)22-20-38-17-13-36(10-2)14-18-38;/h9-22,27-30H,1-2,23-26H2,3-8H3;/q-2;+2/b21-19+,22-20+,43-27-,44-27-,45-28-,46-29-,47-28-,48-29-,49-30-,50-30-; |
| InChIKey | OEYKJYHDBYIBPT-KKFHEGIQSA-N |
| XLogP | 11.28 |
| TPSA | 106.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.37 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|