C41H43FeN7O3 — CID 11434116
iron(2+);methyl 3-[8,13-bis(ethenyl)-18-[3-(3-imidazol-1-ylpropylamino)-3-oxopropyl]-3,7,12,17-tetramethylporphyrin-22,24-diid-2-yl]propanoate (PubChem CID 11434116) has the molecular formula C41H43FeN7O3 and a molecular weight of 737.69 g/mol. Its IUPAC name is iron(2+);methyl 3-[8,13-bis(ethenyl)-18-[3-(3-imidazol-1-ylpropylamino)-3-oxopropyl]-3,7,12,17-tetramethylporphyrin-22,24-diid-2-yl]propanoate.
| Compound Name | iron(2+);methyl 3-[8,13-bis(ethenyl)-18-[3-(3-imidazol-1-ylpropylamino)-3-oxopropyl]-3,7,12,17-tetramethylporphyrin-22,24-diid-2-yl]propanoate |
|---|---|
| PubChem CID | 11434116 |
| Molecular Formula | C41H43FeN7O3 |
| Molecular Weight | 737.69 g/mol |
| Exact Mass | 737.28 |
| IUPAC Name | iron(2+);methyl 3-[8,13-bis(ethenyl)-18-[3-(3-imidazol-1-ylpropylamino)-3-oxopropyl]-3,7,12,17-tetramethylporphyrin-22,24-diid-2-yl]propanoate |
| SMILES | C=CC1=C(C)c2cc3[n-]c(cc4nc(cc5[n-]c(cc1n2)c(C)c5CCC(=O)NCCCn1ccnc1)C(CCC(=O)OC)=C4C)c(C)c3C=C.[Fe+2] |
| InChI | InChI=1S/C41H44N7O3.Fe/c1-8-28-24(3)32-19-33-27(6)31(12-14-41(50)51-7)39(46-33)22-38-30(11-13-40(49)43-15-10-17-48-18-16-42-23-48)26(5)35(47-38)21-37-29(9-2)25(4)34(45-37)20-36(28)44-32;/h8-9,16,18-23H,1-2,10-15,17H2,3-7H3,(H2-,43,44,45,46,47,49);/q-1;+2/p-1/b32-19-,33-19-,34-20-,35-21-,36-20-,37-21-,38-22-,39-22-; |
| InChIKey | WCLOCCRQYWAWOB-BACIZWPASA-M |
| XLogP | 7.17 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.69 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|