C40H44CuN4O8 — CID 636312
copper methyl 3-[8,13,17-tris(3-methoxy-3-oxopropyl)-3,7,12,18-tetramethylporphyrin-21,23-diid-2-yl]propanoate (PubChem CID 636312) has the molecular formula C40H44CuN4O8 and a molecular weight of 772.36 g/mol. Its IUPAC name is copper methyl 3-[8,13,17-tris(3-methoxy-3-oxopropyl)-3,7,12,18-tetramethylporphyrin-21,23-diid-2-yl]propanoate.
| Compound Name | copper methyl 3-[8,13,17-tris(3-methoxy-3-oxopropyl)-3,7,12,18-tetramethylporphyrin-21,23-diid-2-yl]propanoate |
|---|---|
| PubChem CID | 636312 |
| Molecular Formula | C40H44CuN4O8 |
| Molecular Weight | 772.36 g/mol |
| Exact Mass | 771.25 |
| IUPAC Name | copper methyl 3-[8,13,17-tris(3-methoxy-3-oxopropyl)-3,7,12,18-tetramethylporphyrin-21,23-diid-2-yl]propanoate |
| SMILES | COC(=O)CCC1=C(C)c2cc3[n-]c(cc4nc(cc5[n-]c(cc1n2)c(C)c5CCC(=O)OC)C(CCC(=O)OC)=C4C)c(CCC(=O)OC)c3C.[Cu+2] |
| InChI | InChI=1S/C40H44N4O8.Cu/c1-21-25(9-13-37(45)49-5)33-18-31-23(3)27(11-15-39(47)51-7)35(43-31)20-36-28(12-16-40(48)52-8)24(4)32(44-36)19-34-26(10-14-38(46)50-6)22(2)30(42-34)17-29(21)41-33;/h17-20H,9-16H2,1-8H3;/q-2;+2/b29-17-,30-17-,31-18-,32-19-,33-18-,34-19-,35-20-,36-20-; |
| InChIKey | OXYHTUYTTTVPHW-SBAYRDIXSA-N |
| XLogP | 6.17 |
| TPSA | 159.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.36 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|