C32H32ClFeN4O6 — CID 86572614
3-[18-(2-carboxyethyl)-8,13-bis(hydroxymethyl)-3,7,12,17-tetramethylporphyrin-22,23-diid-2-yl]propanoic acid;iron(3+);chloride (PubChem CID 86572614) has the molecular formula C32H32ClFeN4O6 and a molecular weight of 659.93 g/mol. Its IUPAC name is 3-[18-(2-carboxyethyl)-8,13-bis(hydroxymethyl)-3,7,12,17-tetramethylporphyrin-22,23-diid-2-yl]propanoic acid;iron(3+);chloride.
| Compound Name | 3-[18-(2-carboxyethyl)-8,13-bis(hydroxymethyl)-3,7,12,17-tetramethylporphyrin-22,23-diid-2-yl]propanoic acid;iron(3+);chloride |
|---|---|
| PubChem CID | 86572614 |
| Molecular Formula | C32H32ClFeN4O6 |
| Molecular Weight | 659.93 g/mol |
| Exact Mass | 659.14 |
| IUPAC Name | 3-[18-(2-carboxyethyl)-8,13-bis(hydroxymethyl)-3,7,12,17-tetramethylporphyrin-22,23-diid-2-yl]propanoic acid;iron(3+);chloride |
| SMILES | CC1=C(CCC(=O)O)c2cc3nc(cc4[n-]c(cc5[n-]c(cc1n2)c(C)c5CO)c(C)c4CO)C(C)=C3CCC(=O)O.[Cl-].[Fe+3] |
| InChI | InChI=1S/C32H34N4O6.ClH.Fe/c1-15-19(5-7-31(39)40)27-12-28-20(6-8-32(41)42)16(2)25(34-28)10-29-22(14-38)18(4)26(36-29)11-30-21(13-37)17(3)24(35-30)9-23(15)33-27;;/h9-12,37-38H,5-8,13-14H2,1-4H3,(H4,33,34,35,36,39,40,41,42);1H;/q;;+3/p-3/b23-9-,24-9-,25-10-,26-11-,27-12-,28-12-,29-10-,30-11-;; |
| InChIKey | MLBCUHDDMWYTEE-KCLSAIHASA-K |
| XLogP | 1.77 |
| TPSA | 169.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.93 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|