C36H36FeN4O10 — CID 42626843
3-[12,17-bis(2-carboxyethyl)-8-[(2R)-2-hydroxy-2-(3-hydroxydioxiran-3-yl)ethyl]-3,7,13,18-tetramethylporphyrin-21,23-diid-2-yl]propanoic acid;iron(2+) (PubChem CID 42626843) has the molecular formula C36H36FeN4O10 and a molecular weight of 740.55 g/mol. Its IUPAC name is 3-[12,17-bis(2-carboxyethyl)-8-[(2R)-2-hydroxy-2-(3-hydroxydioxiran-3-yl)ethyl]-3,7,13,18-tetramethylporphyrin-21,23-diid-2-yl]propanoic acid;iron(2+).
| Compound Name | 3-[12,17-bis(2-carboxyethyl)-8-[(2R)-2-hydroxy-2-(3-hydroxydioxiran-3-yl)ethyl]-3,7,13,18-tetramethylporphyrin-21,23-diid-2-yl]propanoic acid;iron(2+) |
|---|---|
| PubChem CID | 42626843 |
| Molecular Formula | C36H36FeN4O10 |
| Molecular Weight | 740.55 g/mol |
| Exact Mass | 740.18 |
| IUPAC Name | 3-[12,17-bis(2-carboxyethyl)-8-[(2R)-2-hydroxy-2-(3-hydroxydioxiran-3-yl)ethyl]-3,7,13,18-tetramethylporphyrin-21,23-diid-2-yl]propanoic acid;iron(2+) |
| SMILES | CC1=C(CCC(=O)O)c2cc3[n-]c(cc4nc(cc5[n-]c(cc1n2)c(CCC(=O)O)c5C)C(C)=C4C[C@@H](O)C1(O)OO1)c(CCC(=O)O)c3C.[Fe+2] |
| InChI | InChI=1S/C36H38N4O10.Fe/c1-16-20(5-8-33(42)43)28-13-26-17(2)21(6-9-34(44)45)29(38-26)14-27-18(3)22(7-10-35(46)47)30(39-27)15-31-23(11-32(41)36(48)49-50-36)19(4)25(40-31)12-24(16)37-28;/h12-15,32,41,48H,5-11H2,1-4H3,(H5,37,38,39,40,42,43,44,45,46,47);/q;+2/p-2/b24-12-,25-12-,26-13-,27-14-,28-13-,29-14-,30-15-,31-15-;/t32-;/m1./s1 |
| InChIKey | RCBJGVXPYYRUPW-ATVJWZSASA-L |
| XLogP | 4.31 |
| TPSA | 231.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.55 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|