C34H30FeN4O4 — CID 6102687
3-[18-(2-carboxyethyl)-8-ethenyl-13-ethynyl-3,7,12,17-tetramethylporphyrin-21,23-diid-2-yl]propanoic acid;iron(2+) (PubChem CID 6102687) has the molecular formula C34H30FeN4O4 and a molecular weight of 614.48 g/mol. Its IUPAC name is 3-[18-(2-carboxyethyl)-8-ethenyl-13-ethynyl-3,7,12,17-tetramethylporphyrin-21,23-diid-2-yl]propanoic acid;iron(2+).
| Compound Name | 3-[18-(2-carboxyethyl)-8-ethenyl-13-ethynyl-3,7,12,17-tetramethylporphyrin-21,23-diid-2-yl]propanoic acid;iron(2+) |
|---|---|
| PubChem CID | 6102687 |
| Molecular Formula | C34H30FeN4O4 |
| Molecular Weight | 614.48 g/mol |
| Exact Mass | 614.16 |
| IUPAC Name | 3-[18-(2-carboxyethyl)-8-ethenyl-13-ethynyl-3,7,12,17-tetramethylporphyrin-21,23-diid-2-yl]propanoic acid;iron(2+) |
| SMILES | C#Cc1c(C)c2cc3nc(cc4[n-]c(cc5nc(cc1[n-]2)C(C)=C5CCC(=O)O)c(CCC(=O)O)c4C)C(C)=C3C=C.[Fe+2] |
| InChI | InChI=1S/C34H32N4O4.Fe/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25;/h2,7,13-16H,1,9-12H2,3-6H3,(H4,35,36,37,38,39,40,41,42);/q;+2/p-2/b25-13-,26-13-,27-14-,28-15-,29-14-,30-15-,31-16-,32-16-; |
| InChIKey | LXKHZXHEAZEZEK-RGGAHWMASA-L |
| XLogP | 6.10 |
| TPSA | 128.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.48 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|