C34H32FeN4O4S — CID 42627360
3-[18-(2-carboxyethyl)-8-ethenyl-3,7,12,17-tetramethyl-13-(1-sulfanylethenyl)porphyrin-21,23-diid-2-yl]propanoic acid;iron(2+) (PubChem CID 42627360) has the molecular formula C34H32FeN4O4S and a molecular weight of 648.57 g/mol. Its IUPAC name is 3-[18-(2-carboxyethyl)-8-ethenyl-3,7,12,17-tetramethyl-13-(1-sulfanylethenyl)porphyrin-21,23-diid-2-yl]propanoic acid;iron(2+).
| Compound Name | 3-[18-(2-carboxyethyl)-8-ethenyl-3,7,12,17-tetramethyl-13-(1-sulfanylethenyl)porphyrin-21,23-diid-2-yl]propanoic acid;iron(2+) |
|---|---|
| PubChem CID | 42627360 |
| Molecular Formula | C34H32FeN4O4S |
| Molecular Weight | 648.57 g/mol |
| Exact Mass | 648.15 |
| IUPAC Name | 3-[18-(2-carboxyethyl)-8-ethenyl-3,7,12,17-tetramethyl-13-(1-sulfanylethenyl)porphyrin-21,23-diid-2-yl]propanoic acid;iron(2+) |
| SMILES | C=CC1=C(C)c2cc3[n-]c(cc4nc(cc5[n-]c(cc1n2)c(C)c5C(=C)S)C(C)=C4CCC(=O)O)c(CCC(=O)O)c3C.[Fe+2] |
| InChI | InChI=1S/C34H34N4O4S.Fe/c1-7-21-16(2)24-12-25-17(3)22(8-10-32(39)40)29(36-25)15-30-23(9-11-33(41)42)18(4)26(37-30)14-31-34(20(6)43)19(5)27(38-31)13-28(21)35-24;/h7,12-15H,1,6,8-11H2,2-5H3,(H5,35,36,37,38,39,40,41,42,43);/q;+2/p-2/b24-12-,25-12-,26-14-,27-13-,28-13-,29-15-,30-15-,31-14-; |
| InChIKey | QQTQYGPPWLZAIO-DRLFZNBHSA-L |
| XLogP | 7.02 |
| TPSA | 128.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.57 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|