C34H30N4O4Zn — CID 51049622
zinc 3-[18-(2-carboxyethyl)-13-ethenyl-8-ethynyl-3,7,12,17-tetramethylporphyrin-21,23-diid-2-yl]propanoic acid (PubChem CID 51049622) has the molecular formula C34H30N4O4Zn and a molecular weight of 624.03 g/mol. Its IUPAC name is zinc 3-[18-(2-carboxyethyl)-13-ethenyl-8-ethynyl-3,7,12,17-tetramethylporphyrin-21,23-diid-2-yl]propanoic acid.
| Compound Name | zinc 3-[18-(2-carboxyethyl)-13-ethenyl-8-ethynyl-3,7,12,17-tetramethylporphyrin-21,23-diid-2-yl]propanoic acid |
|---|---|
| PubChem CID | 51049622 |
| Molecular Formula | C34H30N4O4Zn |
| Molecular Weight | 624.03 g/mol |
| Exact Mass | 622.16 |
| IUPAC Name | zinc 3-[18-(2-carboxyethyl)-13-ethenyl-8-ethynyl-3,7,12,17-tetramethylporphyrin-21,23-diid-2-yl]propanoic acid |
| SMILES | C#CC1=C(C)c2cc3[n-]c(cc4nc(cc5[n-]c(cc1n2)c(C)c5C=C)C(C)=C4CCC(=O)O)c(CCC(=O)O)c3C.[Zn+2] |
| InChI | InChI=1S/C34H32N4O4.Zn/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25;/h1,8,13-16H,2,9-12H2,3-6H3,(H4,35,36,37,38,39,40,41,42);/q;+2/p-2/b25-13-,26-13-,27-14-,28-15-,29-14-,30-15-,31-16-,32-16-; |
| InChIKey | JLCIBFNQYHYDDB-RGGAHWMASA-L |
| XLogP | 6.21 |
| TPSA | 128.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.03 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|