C44H40N4Zn — CID 57375379
zinc 2-anthracen-9-yl-7,12,17-triethyl-3,8,13,18-tetramethylporphyrin-21,23-diide (PubChem CID 57375379) has the molecular formula C44H40N4Zn and a molecular weight of 690.22 g/mol. Its IUPAC name is zinc 2-anthracen-9-yl-7,12,17-triethyl-3,8,13,18-tetramethylporphyrin-21,23-diide.
| Compound Name | zinc 2-anthracen-9-yl-7,12,17-triethyl-3,8,13,18-tetramethylporphyrin-21,23-diide |
|---|---|
| PubChem CID | 57375379 |
| Molecular Formula | C44H40N4Zn |
| Molecular Weight | 690.22 g/mol |
| Exact Mass | 688.25 |
| IUPAC Name | zinc 2-anthracen-9-yl-7,12,17-triethyl-3,8,13,18-tetramethylporphyrin-21,23-diide |
| SMILES | CCC1=C(C)c2cc3[n-]c(cc4nc(cc5[n-]c(cc1n2)c(C)c5CC)C(C)=C4CC)c(C)c3-c1c2ccccc2cc2ccccc12.[Zn+2] |
| InChI | InChI=1S/C44H40N4.Zn/c1-8-30-24(4)35-21-40-32(10-3)26(6)37(47-40)23-42-43(44-33-17-13-11-15-28(33)19-29-16-12-14-18-34(29)44)27(7)38(48-42)22-41-31(9-2)25(5)36(46-41)20-39(30)45-35;/h11-23H,8-10H2,1-7H3;/q-2;+2/b35-21-,36-20-,37-23-,38-22-,39-20-,40-21-,41-22-,42-23-; |
| InChIKey | OTSPWUCKZLSIDR-BYVROXLVSA-N |
| XLogP | 11.40 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.22 |
| LogP ≤ 5 | 11.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|