C38H44N4Zn — CID 11039412
zinc 2,7-diethyl-3,8,12,18-tetramethyl-13,17-bis(3-methylbut-3-enyl)porphyrin-22,24-diide (PubChem CID 11039412) has the molecular formula C38H44N4Zn and a molecular weight of 622.19 g/mol. Its IUPAC name is zinc 2,7-diethyl-3,8,12,18-tetramethyl-13,17-bis(3-methylbut-3-enyl)porphyrin-22,24-diide.
| Compound Name | zinc 2,7-diethyl-3,8,12,18-tetramethyl-13,17-bis(3-methylbut-3-enyl)porphyrin-22,24-diide |
|---|---|
| PubChem CID | 11039412 |
| Molecular Formula | C38H44N4Zn |
| Molecular Weight | 622.19 g/mol |
| Exact Mass | 620.29 |
| IUPAC Name | zinc 2,7-diethyl-3,8,12,18-tetramethyl-13,17-bis(3-methylbut-3-enyl)porphyrin-22,24-diide |
| SMILES | C=C(C)CCC1=C(C)c2cc3[n-]c(cc4nc(cc5[n-]c(cc1n2)c(CCC(=C)C)c5C)C(CC)=C4C)c(CC)c3C.[Zn+2] |
| InChI | InChI=1S/C38H44N4.Zn/c1-11-27-23(7)31-17-32-25(9)29(15-13-21(3)4)37(41-32)20-38-30(16-14-22(5)6)26(10)34(42-38)19-36-28(12-2)24(8)33(40-36)18-35(27)39-31;/h17-20H,3,5,11-16H2,1-2,4,6-10H3;/q-2;+2/b31-17-,32-17-,33-18-,34-19-,35-18-,36-19-,37-20-,38-20-; |
| InChIKey | HYFDYXLNVYFNAI-ADRFTTKGSA-N |
| XLogP | 9.89 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.19 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|