C38H44N4O4Zn — CID 15968499
zinc ethyl 3-[3-(3-ethoxy-3-oxopropyl)-7,8,17,18-tetraethylporphyrin-21,24-diid-2-yl]propanoate (PubChem CID 15968499) has the molecular formula C38H44N4O4Zn and a molecular weight of 686.18 g/mol. Its IUPAC name is zinc ethyl 3-[3-(3-ethoxy-3-oxopropyl)-7,8,17,18-tetraethylporphyrin-21,24-diid-2-yl]propanoate.
| Compound Name | zinc ethyl 3-[3-(3-ethoxy-3-oxopropyl)-7,8,17,18-tetraethylporphyrin-21,24-diid-2-yl]propanoate |
|---|---|
| PubChem CID | 15968499 |
| Molecular Formula | C38H44N4O4Zn |
| Molecular Weight | 686.18 g/mol |
| Exact Mass | 684.27 |
| IUPAC Name | zinc ethyl 3-[3-(3-ethoxy-3-oxopropyl)-7,8,17,18-tetraethylporphyrin-21,24-diid-2-yl]propanoate |
| SMILES | CCOC(=O)CCc1c(CCC(=O)OCC)c2cc3[n-]c(cc4nc(cc5nc(cc1[n-]2)C(CC)=C5CC)C=C4)c(CC)c3CC.[Zn+2] |
| InChI | InChI=1S/C38H44N4O4.Zn/c1-7-25-27(9-3)33-21-35-29(15-17-37(43)45-11-5)30(16-18-38(44)46-12-6)36(42-35)22-34-28(10-4)26(8-2)32(41-34)20-24-14-13-23(39-24)19-31(25)40-33;/h13-14,19-22H,7-12,15-18H2,1-6H3;/q-2;+2/b23-19-,24-20-,31-19-,32-20-,33-21-,34-22-,35-21-,36-22-; |
| InChIKey | NQDQZYDSPSLDLN-SKCPUNDOSA-N |
| XLogP | 7.59 |
| TPSA | 106.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.18 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|