C84H124N4O16Zn — CID 10772839
zinc hexyl 2-[3,7,8,12,13,17,18-heptakis(2-hexoxy-2-oxoethyl)porphyrin-21,23-diid-2-yl]acetate (PubChem CID 10772839) has the molecular formula C84H124N4O16Zn and a molecular weight of 1511.32 g/mol. Its IUPAC name is zinc hexyl 2-[3,7,8,12,13,17,18-heptakis(2-hexoxy-2-oxoethyl)porphyrin-21,23-diid-2-yl]acetate.
| Compound Name | zinc hexyl 2-[3,7,8,12,13,17,18-heptakis(2-hexoxy-2-oxoethyl)porphyrin-21,23-diid-2-yl]acetate |
|---|---|
| PubChem CID | 10772839 |
| Molecular Formula | C84H124N4O16Zn |
| Molecular Weight | 1511.32 g/mol |
| Exact Mass | 1508.83 |
| IUPAC Name | zinc hexyl 2-[3,7,8,12,13,17,18-heptakis(2-hexoxy-2-oxoethyl)porphyrin-21,23-diid-2-yl]acetate |
| SMILES | CCCCCCOC(=O)CC1=C(CC(=O)OCCCCCC)c2cc3[n-]c(cc4nc(cc5[n-]c(cc1n2)c(CC(=O)OCCCCCC)c5CC(=O)OCCCCCC)C(CC(=O)OCCCCCC)=C4CC(=O)OCCCCCC)c(CC(=O)OCCCCCC)c3CC(=O)OCCCCCC.[Zn+2] |
| InChI | InChI=1S/C84H124N4O16.Zn/c1-9-17-25-33-41-97-77(89)49-61-62(50-78(90)98-42-34-26-18-10-2)70-58-72-65(53-81(93)101-45-37-29-21-13-5)66(54-82(94)102-46-38-30-22-14-6)74(87-72)60-76-68(56-84(96)104-48-40-32-24-16-8)67(55-83(95)103-47-39-31-23-15-7)75(88-76)59-73-64(52-80(92)100-44-36-28-20-12-4)63(71(86-73)57-69(61)85-70)51-79(91)99-43-35-27-19-11-3;/h57-60H,9-56H2,1-8H3;/q-2;+2/b69-57-,70-58-,71-57-,72-58-,73-59-,74-60-,75-59-,76-60-; |
| InChIKey | HXFZJVFXMFEAOA-XMFGLIBJSA-N |
| XLogP | 18.11 |
| TPSA | 264.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 56 |
| Heavy Atoms | 105 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1511.32 |
| LogP ≤ 5 | 18.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|