C56H52N4O8Zn — CID 15970050
zinc methyl 3-[5,15-bis(4-ethynylphenyl)-8,12,18-tris(3-methoxy-3-oxopropyl)-3,7,13,17-tetramethylporphyrin-21,22-diid-2-yl]propanoate (PubChem CID 15970050) has the molecular formula C56H52N4O8Zn and a molecular weight of 974.44 g/mol. Its IUPAC name is zinc methyl 3-[5,15-bis(4-ethynylphenyl)-8,12,18-tris(3-methoxy-3-oxopropyl)-3,7,13,17-tetramethylporphyrin-21,22-diid-2-yl]propanoate.
| Compound Name | zinc methyl 3-[5,15-bis(4-ethynylphenyl)-8,12,18-tris(3-methoxy-3-oxopropyl)-3,7,13,17-tetramethylporphyrin-21,22-diid-2-yl]propanoate |
|---|---|
| PubChem CID | 15970050 |
| Molecular Formula | C56H52N4O8Zn |
| Molecular Weight | 974.44 g/mol |
| Exact Mass | 972.31 |
| IUPAC Name | zinc methyl 3-[5,15-bis(4-ethynylphenyl)-8,12,18-tris(3-methoxy-3-oxopropyl)-3,7,13,17-tetramethylporphyrin-21,22-diid-2-yl]propanoate |
| SMILES | C#Cc1ccc(-c2c3nc(cc4[n-]c(c(C)c4CCC(=O)OC)c(-c4ccc(C#C)cc4)c4[n-]c(cc5nc2C(C)=C5CCC(=O)OC)c(CCC(=O)OC)c4C)C(CCC(=O)OC)=C3C)cc1.[Zn+2] |
| InChI | InChI=1S/C56H52N4O8.Zn/c1-11-35-13-17-37(18-14-35)51-53-31(3)39(21-25-47(61)65-7)43(57-53)29-45-41(23-27-49(63)67-9)33(5)55(59-45)52(38-19-15-36(12-2)16-20-38)56-34(6)42(24-28-50(64)68-10)46(60-56)30-44-40(22-26-48(62)66-8)32(4)54(51)58-44;/h1-2,13-20,29-30H,21-28H2,3-10H3;/q-2;+2/b43-29-,44-30-,45-29-,46-30-,53-51-,54-51-,55-52-,56-52-; |
| InChIKey | TUHUULPBKLNYMW-JZVFTGOLSA-N |
| XLogP | 9.46 |
| TPSA | 159.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 974.44 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|