C44H48N4O6Zn — CID 15969716
zinc methyl 3-[10-(2,5-dimethoxyphenyl)-7,13-diethyl-18-(3-methoxy-3-oxopropyl)-3,8,12,17-tetramethylporphyrin-22,23-diid-2-yl]propanoate (PubChem CID 15969716) has the molecular formula C44H48N4O6Zn and a molecular weight of 794.28 g/mol. Its IUPAC name is zinc methyl 3-[10-(2,5-dimethoxyphenyl)-7,13-diethyl-18-(3-methoxy-3-oxopropyl)-3,8,12,17-tetramethylporphyrin-22,23-diid-2-yl]propanoate.
| Compound Name | zinc methyl 3-[10-(2,5-dimethoxyphenyl)-7,13-diethyl-18-(3-methoxy-3-oxopropyl)-3,8,12,17-tetramethylporphyrin-22,23-diid-2-yl]propanoate |
|---|---|
| PubChem CID | 15969716 |
| Molecular Formula | C44H48N4O6Zn |
| Molecular Weight | 794.28 g/mol |
| Exact Mass | 792.29 |
| IUPAC Name | zinc methyl 3-[10-(2,5-dimethoxyphenyl)-7,13-diethyl-18-(3-methoxy-3-oxopropyl)-3,8,12,17-tetramethylporphyrin-22,23-diid-2-yl]propanoate |
| SMILES | CCc1c(C)c2[n-]c1cc1nc(cc3nc(cc4[n-]c(c(C)c4CC)c2-c2cc(OC)ccc2OC)C(C)=C3CCC(=O)OC)C(CCC(=O)OC)=C1C.[Zn+2] |
| InChI | InChI=1S/C44H48N4O6.Zn/c1-11-28-25(5)43-42(32-19-27(51-7)13-16-39(32)52-8)44-26(6)29(12-2)36(48-44)21-34-24(4)31(15-18-41(50)54-10)38(46-34)22-37-30(14-17-40(49)53-9)23(3)33(45-37)20-35(28)47-43;/h13,16,19-22H,11-12,14-15,17-18H2,1-10H3;/q-2;+2/b33-20-,34-21-,35-20-,36-21-,37-22-,38-22-,43-42-,44-42-; |
| InChIKey | XYNBREZIJPHOEI-CYWBOJNASA-N |
| XLogP | 8.76 |
| TPSA | 125.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.28 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|