C36H42N4O4 — CID 11801640
methyl 3-[13,17-diethyl-8-(3-methoxy-3-oxopropyl)-3,7,12,18-tetramethyl-23,24-dihydroporphyrin-2-yl]propanoate (PubChem CID 11801640) has the molecular formula C36H42N4O4 and a molecular weight of 594.76 g/mol. Its IUPAC name is methyl 3-[13,17-diethyl-8-(3-methoxy-3-oxopropyl)-3,7,12,18-tetramethyl-23,24-dihydroporphyrin-2-yl]propanoate.
| Compound Name | methyl 3-[13,17-diethyl-8-(3-methoxy-3-oxopropyl)-3,7,12,18-tetramethyl-23,24-dihydroporphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 11801640 |
| Molecular Formula | C36H42N4O4 |
| Molecular Weight | 594.76 g/mol |
| Exact Mass | 594.32 |
| IUPAC Name | methyl 3-[13,17-diethyl-8-(3-methoxy-3-oxopropyl)-3,7,12,18-tetramethyl-23,24-dihydroporphyrin-2-yl]propanoate |
| SMILES | CCc1c(C)c2cc3nc(cc4nc(cc5[nH]c(cc1[nH]2)c(CC)c5C)C(CCC(=O)OC)=C4C)C(C)=C3CCC(=O)OC |
| InChI | InChI=1S/C36H42N4O4/c1-9-23-19(3)29-16-33-25(11-13-35(41)43-7)21(5)27(39-33)15-28-22(6)26(12-14-36(42)44-8)34(40-28)17-30-20(4)24(10-2)32(38-30)18-31(23)37-29/h15-18,37-38H,9-14H2,1-8H3/b27-15-,28-15-,29-16-,30-17-,31-18-,32-18-,33-16-,34-17- |
| InChIKey | DYEPXJZEJKIBFM-CRTOKUQMSA-N |
| XLogP | 7.82 |
| TPSA | 109.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.76 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |