C32H35BrN4O2 — CID 23264045
methyl 3-(8-bromo-13,18-diethyl-3,7,12,17-tetramethyl-22,24-dihydroporphyrin-2-yl)propanoate (PubChem CID 23264045) has the molecular formula C32H35BrN4O2 and a molecular weight of 587.56 g/mol. Its IUPAC name is methyl 3-(8-bromo-13,18-diethyl-3,7,12,17-tetramethyl-22,24-dihydroporphyrin-2-yl)propanoate.
| Compound Name | methyl 3-(8-bromo-13,18-diethyl-3,7,12,17-tetramethyl-22,24-dihydroporphyrin-2-yl)propanoate |
|---|---|
| PubChem CID | 23264045 |
| Molecular Formula | C32H35BrN4O2 |
| Molecular Weight | 587.56 g/mol |
| Exact Mass | 586.19 |
| IUPAC Name | methyl 3-(8-bromo-13,18-diethyl-3,7,12,17-tetramethyl-22,24-dihydroporphyrin-2-yl)propanoate |
| SMILES | CCC1=C(C)c2cc3[nH]c(cc4nc(cc5[nH]c(cc1n2)c(C)c5CC)C(CCC(=O)OC)=C4C)c(C)c3Br |
| InChI | InChI=1S/C32H35BrN4O2/c1-8-20-17(4)25-14-30-32(33)19(6)26(37-30)12-23-18(5)22(10-11-31(38)39-7)29(36-23)15-28-21(9-2)16(3)24(34-28)13-27(20)35-25/h12-15,34,37H,8-11H2,1-7H3/b23-12-,24-13-,25-14-,26-12-,27-13-,28-15-,29-15-,30-14- |
| InChIKey | JGTRMWZETNSGJM-DMQUXRTFSA-N |
| XLogP | 8.48 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.56 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |