C36H37N5O6 — CID 23258165
methyl 3-[17-cyano-8,12-bis(3-methoxy-3-oxopropyl)-3,7,13-trimethyl-21,24-dihydroporphyrin-2-yl]propanoate (PubChem CID 23258165) has the molecular formula C36H37N5O6 and a molecular weight of 635.72 g/mol. Its IUPAC name is methyl 3-[17-cyano-8,12-bis(3-methoxy-3-oxopropyl)-3,7,13-trimethyl-21,24-dihydroporphyrin-2-yl]propanoate.
| Compound Name | methyl 3-[17-cyano-8,12-bis(3-methoxy-3-oxopropyl)-3,7,13-trimethyl-21,24-dihydroporphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 23258165 |
| Molecular Formula | C36H37N5O6 |
| Molecular Weight | 635.72 g/mol |
| Exact Mass | 635.27 |
| IUPAC Name | methyl 3-[17-cyano-8,12-bis(3-methoxy-3-oxopropyl)-3,7,13-trimethyl-21,24-dihydroporphyrin-2-yl]propanoate |
| SMILES | COC(=O)CCC1=C(C)c2cc3[nH]c(cc3C#N)cc3[nH]c(cc4nc(cc1n2)C(CCC(=O)OC)=C4C)c(C)c3CCC(=O)OC |
| InChI | InChI=1S/C36H37N5O6/c1-19-24(7-10-34(42)45-4)31-14-23-13-22(18-37)30(38-23)16-29-21(3)26(9-12-36(44)47-6)33(41-29)17-32-25(8-11-35(43)46-5)20(2)28(40-32)15-27(19)39-31/h13-17,38-39H,7-12H2,1-6H3/b23-14-,27-15-,28-15-,29-16-,30-16-,31-14-,32-17-,33-17- |
| InChIKey | ALEZPNILGAOPLJ-PHBZQCKCSA-N |
| XLogP | 6.37 |
| TPSA | 160.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.72 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|