C42H46N4O12 — CID 101074035
2-[8-(carboxymethyl)-3,7,12,17-tetrakis(3-methoxy-3-oxopropyl)-13,18-dimethyl-21,22-dihydroporphyrin-2-yl]acetic acid (PubChem CID 101074035) has the molecular formula C42H46N4O12 and a molecular weight of 798.85 g/mol. Its IUPAC name is 2-[8-(carboxymethyl)-3,7,12,17-tetrakis(3-methoxy-3-oxopropyl)-13,18-dimethyl-21,22-dihydroporphyrin-2-yl]acetic acid.
| Compound Name | 2-[8-(carboxymethyl)-3,7,12,17-tetrakis(3-methoxy-3-oxopropyl)-13,18-dimethyl-21,22-dihydroporphyrin-2-yl]acetic acid |
|---|---|
| PubChem CID | 101074035 |
| Molecular Formula | C42H46N4O12 |
| Molecular Weight | 798.85 g/mol |
| Exact Mass | 798.31 |
| IUPAC Name | 2-[8-(carboxymethyl)-3,7,12,17-tetrakis(3-methoxy-3-oxopropyl)-13,18-dimethyl-21,22-dihydroporphyrin-2-yl]acetic acid |
| SMILES | COC(=O)CCC1=C(C)c2cc3[nH]c(cc4[nH]c(cc5nc(cc1n2)C(C)=C5CCC(=O)OC)c(CC(=O)O)c4CCC(=O)OC)c(CCC(=O)OC)c3CC(=O)O |
| InChI | InChI=1S/C42H46N4O12/c1-21-23(7-11-39(51)55-3)31-17-29-22(2)24(8-12-40(52)56-4)32(44-29)19-36-28(16-38(49)50)26(10-14-42(54)58-6)34(46-36)20-33-25(9-13-41(53)57-5)27(15-37(47)48)35(45-33)18-30(21)43-31/h17-20,45-46H,7-16H2,1-6H3,(H,47,48)(H,49,50)/b29-17-,30-18-,31-17-,32-19-,33-20-,34-20-,35-18-,36-19- |
| InChIKey | PVVCXTIPQXRHOU-FQZRJDFASA-N |
| XLogP | 5.55 |
| TPSA | 237.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.85 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|