C39H38N4O14 — CID 14747314
3-[8,12,17-tris(2-carboxyethyl)-7,13,18-tris(carboxymethyl)-3-methyl-22,23-dihydroporphyrin-2-yl]propanoic acid (PubChem CID 14747314) has the molecular formula C39H38N4O14 and a molecular weight of 786.75 g/mol. Its IUPAC name is 3-[8,12,17-tris(2-carboxyethyl)-7,13,18-tris(carboxymethyl)-3-methyl-22,23-dihydroporphyrin-2-yl]propanoic acid.
| Compound Name | 3-[8,12,17-tris(2-carboxyethyl)-7,13,18-tris(carboxymethyl)-3-methyl-22,23-dihydroporphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 14747314 |
| Molecular Formula | C39H38N4O14 |
| Molecular Weight | 786.75 g/mol |
| Exact Mass | 786.24 |
| IUPAC Name | 3-[8,12,17-tris(2-carboxyethyl)-7,13,18-tris(carboxymethyl)-3-methyl-22,23-dihydroporphyrin-2-yl]propanoic acid |
| SMILES | CC1=C(CCC(=O)O)c2cc3nc(cc4[nH]c(cc5[nH]c(cc1n2)c(CC(=O)O)c5CCC(=O)O)c(CCC(=O)O)c4CC(=O)O)C(CCC(=O)O)=C3CC(=O)O |
| InChI | InChI=1S/C39H38N4O14/c1-17-18(2-6-33(44)45)26-14-31-23(11-38(54)55)21(5-9-36(50)51)29(43-31)16-32-24(12-39(56)57)20(4-8-35(48)49)28(42-32)15-27-19(3-7-34(46)47)22(10-37(52)53)30(41-27)13-25(17)40-26/h13-16,41-42H,2-12H2,1H3,(H,44,45)(H,46,47)(H,48,49)(H,50,51)(H,52,53)(H,54,55)(H,56,57)/b25-13-,26-14-,27-15-,28-15-,29-16-,30-13-,31-14-,32-16- |
| InChIKey | TTZFTDFJTQMSFY-NQPVHXQTSA-N |
| XLogP | 4.65 |
| TPSA | 318.46 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.75 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |