C36H33N4O8-3 — CID 20849162
3-[13,18-bis(2-carboxylatoethyl)-17-(carboxymethyl)-8-ethenyl-3,7,12-trimethyl-22,24-dihydroporphyrin-2-yl]propanoate (PubChem CID 20849162) has the molecular formula C36H33N4O8-3 and a molecular weight of 649.68 g/mol. Its IUPAC name is 3-[13,18-bis(2-carboxylatoethyl)-17-(carboxymethyl)-8-ethenyl-3,7,12-trimethyl-22,24-dihydroporphyrin-2-yl]propanoate.
| Compound Name | 3-[13,18-bis(2-carboxylatoethyl)-17-(carboxymethyl)-8-ethenyl-3,7,12-trimethyl-22,24-dihydroporphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 20849162 |
| Molecular Formula | C36H33N4O8-3 |
| Molecular Weight | 649.68 g/mol |
| Exact Mass | 649.23 |
| IUPAC Name | 3-[13,18-bis(2-carboxylatoethyl)-17-(carboxymethyl)-8-ethenyl-3,7,12-trimethyl-22,24-dihydroporphyrin-2-yl]propanoate |
| SMILES | C=Cc1c(C)c2cc3nc(cc4[nH]c(cc5nc(cc1[nH]2)C(C)=C5CCC(=O)[O-])c(CC(=O)O)c4CCC(=O)[O-])C(CCC(=O)[O-])=C3C |
| InChI | InChI=1S/C36H36N4O8/c1-5-20-17(2)25-13-26-18(3)21(6-9-33(41)42)29(38-26)15-31-23(8-11-35(45)46)24(12-36(47)48)32(40-31)16-30-22(7-10-34(43)44)19(4)27(39-30)14-28(20)37-25/h5,13-16,37,40H,1,6-12H2,2-4H3,(H,41,42)(H,43,44)(H,45,46)(H,47,48)/p-3/b25-13-,26-13-,27-14-,28-14-,29-15-,30-16-,31-15-,32-16- |
| InChIKey | WFGYAKUWXOQPHP-TXUIXYGZSA-K |
| XLogP | 2.50 |
| TPSA | 215.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.68 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |