C35H36N4O2 — CID 163385134
3-[18-but-3-enyl-8,13-bis(ethenyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid (PubChem CID 163385134) has the molecular formula C35H36N4O2 and a molecular weight of 544.70 g/mol. Its IUPAC name is 3-[18-but-3-enyl-8,13-bis(ethenyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid.
| Compound Name | 3-[18-but-3-enyl-8,13-bis(ethenyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 163385134 |
| Molecular Formula | C35H36N4O2 |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 544.28 |
| IUPAC Name | 3-[18-but-3-enyl-8,13-bis(ethenyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid |
| SMILES | C=CCCC1=C(C)c2cc3[nH]c(cc4[nH]c(cc5nc(cc1n2)C(CCC(=O)O)=C5C)c(C)c4C=C)c(C)c3C=C |
| InChI | InChI=1S/C35H36N4O2/c1-8-11-12-25-21(6)30-17-32-24(10-3)20(5)29(37-32)16-31-23(9-2)19(4)27(36-31)15-28-22(7)26(13-14-35(40)41)34(38-28)18-33(25)39-30/h8-10,15-18,36-37H,1-3,11-14H2,4-7H3,(H,40,41)/b27-15-,28-15-,29-16-,30-17-,31-16-,32-17-,33-18-,34-18- |
| InChIKey | DRCKKFXISXIHBK-MFBGAUBSSA-N |
| XLogP | 8.91 |
| TPSA | 94.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|