C35H37N5O3 — CID 143862753
3-[7,12-bis(ethenyl)-3,8,13,17-tetramethyl-18-[3-(methylamino)-3-oxopropyl]-22,23-dihydroporphyrin-2-yl]propanoic acid (PubChem CID 143862753) has the molecular formula C35H37N5O3 and a molecular weight of 575.71 g/mol. Its IUPAC name is 3-[7,12-bis(ethenyl)-3,8,13,17-tetramethyl-18-[3-(methylamino)-3-oxopropyl]-22,23-dihydroporphyrin-2-yl]propanoic acid.
| Compound Name | 3-[7,12-bis(ethenyl)-3,8,13,17-tetramethyl-18-[3-(methylamino)-3-oxopropyl]-22,23-dihydroporphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 143862753 |
| Molecular Formula | C35H37N5O3 |
| Molecular Weight | 575.71 g/mol |
| Exact Mass | 575.29 |
| IUPAC Name | 3-[7,12-bis(ethenyl)-3,8,13,17-tetramethyl-18-[3-(methylamino)-3-oxopropyl]-22,23-dihydroporphyrin-2-yl]propanoic acid |
| SMILES | C=Cc1c(C)c2cc3[nH]c(cc4nc(cc5nc(cc1[nH]2)C(C)=C5CCC(=O)O)C(CCC(=O)NC)=C4C)c(C)c3C=C |
| InChI | InChI=1S/C35H37N5O3/c1-8-22-18(3)26-14-27-20(5)24(10-12-34(41)36-7)32(39-27)17-33-25(11-13-35(42)43)21(6)29(40-33)16-31-23(9-2)19(4)28(38-31)15-30(22)37-26/h8-9,14-17,37-38H,1-2,10-13H2,3-7H3,(H,36,41)(H,42,43)/b26-14-,27-14-,28-15-,29-16-,30-15-,31-16-,32-17-,33-17- |
| InChIKey | KWQQWXDAUPOYAE-RYKNAGBNSA-N |
| XLogP | 7.47 |
| TPSA | 123.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.71 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |