C40H48N6O3 — CID 154679097
3-[18-[3-[4-(dimethylamino)butylamino]-3-oxopropyl]-8,13-bis(ethenyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid (PubChem CID 154679097) has the molecular formula C40H48N6O3 and a molecular weight of 660.86 g/mol. Its IUPAC name is 3-[18-[3-[4-(dimethylamino)butylamino]-3-oxopropyl]-8,13-bis(ethenyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid.
| Compound Name | 3-[18-[3-[4-(dimethylamino)butylamino]-3-oxopropyl]-8,13-bis(ethenyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 154679097 |
| Molecular Formula | C40H48N6O3 |
| Molecular Weight | 660.86 g/mol |
| Exact Mass | 660.38 |
| IUPAC Name | 3-[18-[3-[4-(dimethylamino)butylamino]-3-oxopropyl]-8,13-bis(ethenyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid |
| SMILES | C=Cc1c(C)c2cc3[nH]c(cc4nc(cc5nc(cc1[nH]2)C(C)=C5CCC(=O)NCCCCN(C)C)C(CCC(=O)O)=C4C)c(C)c3C=C |
| InChI | InChI=1S/C40H48N6O3/c1-9-27-23(3)31-19-32-26(6)30(14-16-40(48)49)38(44-32)22-37-29(13-15-39(47)41-17-11-12-18-46(7)8)25(5)34(45-37)21-36-28(10-2)24(4)33(43-36)20-35(27)42-31/h9-10,19-22,42-43H,1-2,11-18H2,3-8H3,(H,41,47)(H,48,49)/b31-19-,32-19-,33-20-,34-21-,35-20-,36-21-,37-22-,38-22- |
| InChIKey | ASYYOWYDUAICSU-MUCONLFGSA-N |
| XLogP | 8.18 |
| TPSA | 127.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.86 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|