C40H48N6O5 — CID 87118286
3-[18-(2-carboxyethyl)-8,13-bis(ethenyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid;N-[3-(dimethylamino)propyl]formamide (PubChem CID 87118286) has the molecular formula C40H48N6O5 and a molecular weight of 692.86 g/mol. Its IUPAC name is 3-[18-(2-carboxyethyl)-8,13-bis(ethenyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid;N-[3-(dimethylamino)propyl]formamide.
| Compound Name | 3-[18-(2-carboxyethyl)-8,13-bis(ethenyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid;N-[3-(dimethylamino)propyl]formamide |
|---|---|
| PubChem CID | 87118286 |
| Molecular Formula | C40H48N6O5 |
| Molecular Weight | 692.86 g/mol |
| Exact Mass | 692.37 |
| IUPAC Name | 3-[18-(2-carboxyethyl)-8,13-bis(ethenyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid;N-[3-(dimethylamino)propyl]formamide |
| SMILES | C=Cc1c(C)c2cc3[nH]c(cc4nc(cc5nc(cc1[nH]2)C(C)=C5CCC(=O)O)C(CCC(=O)O)=C4C)c(C)c3C=C.CN(C)CCCNC=O |
| InChI | InChI=1S/C34H34N4O4.C6H14N2O/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25;1-8(2)5-3-4-7-6-9/h7-8,13-16,35-36H,1-2,9-12H2,3-6H3,(H,39,40)(H,41,42);6H,3-5H2,1-2H3,(H,7,9)/b25-13-,26-13-,27-14-,28-15-,29-14-,30-15-,31-16-,32-16-; |
| InChIKey | SCDDWXAMPQNIEV-RGGAHWMASA-N |
| XLogP | 7.49 |
| TPSA | 164.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.86 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|