C34H36N4O4 — CID 58969735
3-[7,12-bis(ethenyl)-18-[2-(hydroxymethoxy)ethyl]-3,8,13,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid (PubChem CID 58969735) has the molecular formula C34H36N4O4 and a molecular weight of 564.69 g/mol. Its IUPAC name is 3-[7,12-bis(ethenyl)-18-[2-(hydroxymethoxy)ethyl]-3,8,13,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid.
| Compound Name | 3-[7,12-bis(ethenyl)-18-[2-(hydroxymethoxy)ethyl]-3,8,13,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 58969735 |
| Molecular Formula | C34H36N4O4 |
| Molecular Weight | 564.69 g/mol |
| Exact Mass | 564.27 |
| IUPAC Name | 3-[7,12-bis(ethenyl)-18-[2-(hydroxymethoxy)ethyl]-3,8,13,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid |
| SMILES | C=Cc1c(C)c2cc3[nH]c(cc4nc(cc5nc(cc1[nH]2)C(C)=C5CCC(=O)O)C(CCOCO)=C4C)c(C)c3C=C |
| InChI | InChI=1S/C34H36N4O4/c1-7-22-18(3)26-13-27-21(6)25(11-12-42-17-39)33(37-27)16-32-24(9-10-34(40)41)20(5)29(38-32)15-31-23(8-2)19(4)28(36-31)14-30(22)35-26/h7-8,13-16,35-36,39H,1-2,9-12,17H2,3-6H3,(H,40,41)/b26-13-,27-13-,28-14-,29-15-,30-14-,31-15-,32-16-,33-16- |
| InChIKey | UBOZWNOICPRUIW-NVCPKAQJSA-N |
| XLogP | 7.30 |
| TPSA | 124.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.69 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|