C35H36N4O3 — CID 174141427
3-[7,12-bis(ethenyl)-3,8,13,17-tetramethyl-18-(3-oxobutyl)-22,23-dihydroporphyrin-2-yl]propanoic acid (PubChem CID 174141427) has the molecular formula C35H36N4O3 and a molecular weight of 560.70 g/mol. Its IUPAC name is 3-[7,12-bis(ethenyl)-3,8,13,17-tetramethyl-18-(3-oxobutyl)-22,23-dihydroporphyrin-2-yl]propanoic acid.
| Compound Name | 3-[7,12-bis(ethenyl)-3,8,13,17-tetramethyl-18-(3-oxobutyl)-22,23-dihydroporphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 174141427 |
| Molecular Formula | C35H36N4O3 |
| Molecular Weight | 560.70 g/mol |
| Exact Mass | 560.28 |
| IUPAC Name | 3-[7,12-bis(ethenyl)-3,8,13,17-tetramethyl-18-(3-oxobutyl)-22,23-dihydroporphyrin-2-yl]propanoic acid |
| SMILES | C=Cc1c(C)c2cc3[nH]c(cc4nc(cc5nc(cc1[nH]2)C(C)=C5CCC(=O)O)C(CCC(C)=O)=C4C)c(C)c3C=C |
| InChI | InChI=1S/C35H36N4O3/c1-8-23-19(4)27-14-28-21(6)25(11-10-18(3)40)33(38-28)17-34-26(12-13-35(41)42)22(7)30(39-34)16-32-24(9-2)20(5)29(37-32)15-31(23)36-27/h8-9,14-17,36-37H,1-2,10-13H2,3-7H3,(H,41,42)/b27-14-,28-14-,29-15-,30-16-,31-15-,32-16-,33-17-,34-17- |
| InChIKey | WAHAAVXCOUSEID-SRKXXRNDSA-N |
| XLogP | 8.31 |
| TPSA | 111.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.70 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |