C35H36N4O4 — CID 176529100
3-[8,13-bis(ethenyl)-18-[2-[(2R)-2-hydroxyoxiran-2-yl]ethyl]-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid (PubChem CID 176529100) has the molecular formula C35H36N4O4 and a molecular weight of 576.70 g/mol. Its IUPAC name is 3-[8,13-bis(ethenyl)-18-[2-[(2R)-2-hydroxyoxiran-2-yl]ethyl]-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid.
| Compound Name | 3-[8,13-bis(ethenyl)-18-[2-[(2R)-2-hydroxyoxiran-2-yl]ethyl]-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 176529100 |
| Molecular Formula | C35H36N4O4 |
| Molecular Weight | 576.70 g/mol |
| Exact Mass | 576.27 |
| IUPAC Name | 3-[8,13-bis(ethenyl)-18-[2-[(2R)-2-hydroxyoxiran-2-yl]ethyl]-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid |
| SMILES | C=Cc1c(C)c2cc3[nH]c(cc4nc(cc5nc(cc1[nH]2)C(C)=C5CC[C@]1(O)CO1)C(CCC(=O)O)=C4C)c(C)c3C=C |
| InChI | InChI=1S/C35H36N4O4/c1-7-22-18(3)26-13-27-20(5)24(9-10-34(40)41)32(38-27)16-33-25(11-12-35(42)17-43-35)21(6)29(39-33)15-31-23(8-2)19(4)28(37-31)14-30(22)36-26/h7-8,13-16,36-37,42H,1-2,9-12,17H2,3-6H3,(H,40,41)/b26-13-,27-13-,28-14-,29-15-,30-14-,31-15-,32-16-,33-16-/t35-/m1/s1 |
| InChIKey | QPKMVWWAJJWLMS-XSKONDTQSA-N |
| XLogP | 7.44 |
| TPSA | 127.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.70 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|