C44H53IN6O4 — CID 177441414
3-[7,12-bis(ethenyl)-18-[3-[8-[(2-iodoacetyl)amino]octylamino]-3-oxopropyl]-3,8,13,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid (PubChem CID 177441414) has the molecular formula C44H53IN6O4 and a molecular weight of 856.85 g/mol. Its IUPAC name is 3-[7,12-bis(ethenyl)-18-[3-[8-[(2-iodoacetyl)amino]octylamino]-3-oxopropyl]-3,8,13,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid.
| Compound Name | 3-[7,12-bis(ethenyl)-18-[3-[8-[(2-iodoacetyl)amino]octylamino]-3-oxopropyl]-3,8,13,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 177441414 |
| Molecular Formula | C44H53IN6O4 |
| Molecular Weight | 856.85 g/mol |
| Exact Mass | 856.32 |
| IUPAC Name | 3-[7,12-bis(ethenyl)-18-[3-[8-[(2-iodoacetyl)amino]octylamino]-3-oxopropyl]-3,8,13,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid |
| SMILES | C=Cc1c(C)c2cc3[nH]c(cc4nc(cc5nc(cc1[nH]2)C(C)=C5CCC(=O)O)C(CCC(=O)NCCCCCCCCNC(=O)CI)=C4C)c(C)c3C=C |
| InChI | InChI=1S/C44H53IN6O4/c1-7-30-26(3)34-21-35-28(5)32(15-17-42(52)46-19-13-11-9-10-12-14-20-47-43(53)25-45)40(50-35)24-41-33(16-18-44(54)55)29(6)37(51-41)23-39-31(8-2)27(4)36(49-39)22-38(30)48-34/h7-8,21-24,48-49H,1-2,9-20,25H2,3-6H3,(H,46,52)(H,47,53)(H,54,55)/b34-21-,35-21-,36-22-,37-23-,38-22-,39-23-,40-24-,41-24- |
| InChIKey | NZIVBGADNMLYAW-WWBAUIQFSA-N |
| XLogP | 9.73 |
| TPSA | 152.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.85 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|